About 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione
1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione (PubChem CID 67402743) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione |
| PubChem CID | 67402743 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione |
| SMILES | CCCNN(C)C.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H14N2.C4H3NO2/c1-4-5-6-7(2)3;6-3-1-2-4(7)5-3/h6H,4-5H2,1-3H3;1-2H,(H,5,6,7) |
| InChIKey | JOLVJHLLICAMJZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione?
The IUPAC name of 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione (CID 67402743) is 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione.
What is the SMILES notation for 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione?
The canonical SMILES for 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione is CCCNN(C)C.O=C1C=CC(=O)N1.
What is the InChIKey of 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione?
The InChIKey is JOLVJHLLICAMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2.C4H3NO2/c1-4-5-6-7(2)3;6-3-1-2-4(7)5-3/h6H,4-5H2,1-3H3;1-2H,(H,5,6,7).
What are the key properties of 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione?
1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione has a molecular weight of 199.25 g/mol, XLogP of -0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2-propylhydrazine;pyrrole-2,5-dione is sourced from PubChem (CID 67402743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).