C9H17N3O2 — CID 67402745
N',N'-dimethylpropane-1,3-diamine;pyrrole-2,5-dione (PubChem CID 67402745) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N',N'-dimethylpropane-1,3-diamine;pyrrole-2,5-dione.
| Compound Name | N',N'-dimethylpropane-1,3-diamine;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67402745 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N',N'-dimethylpropane-1,3-diamine;pyrrole-2,5-dione |
| SMILES | CN(C)CCCN.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H14N2.C4H3NO2/c1-7(2)5-3-4-6;6-3-1-2-4(7)5-3/h3-6H2,1-2H3;1-2H,(H,5,6,7) |
| InChIKey | KAGZFTWPZOUXLS-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|