About 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol
2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol (PubChem CID 67403216) has the molecular formula C8H9IN4O
and a molecular weight of 304.09 g/mol. Its IUPAC name is 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol |
| PubChem CID | 67403216 |
| Molecular Formula | C8H9IN4O |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol |
| SMILES | Nc1nccc2c1c(I)nn2CCO |
| InChI | InChI=1S/C8H9IN4O/c9-7-6-5(1-2-11-8(6)10)13(12-7)3-4-14/h1-2,14H,3-4H2,(H2,10,11) |
| InChIKey | DCNIWDHUJZJRHC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol?
The IUPAC name of 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol (CID 67403216) is 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol.
What is the SMILES notation for 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol?
The canonical SMILES for 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol is Nc1nccc2c1c(I)nn2CCO.
What is the InChIKey of 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol?
The InChIKey is DCNIWDHUJZJRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IN4O/c9-7-6-5(1-2-11-8(6)10)13(12-7)3-4-14/h1-2,14H,3-4H2,(H2,10,11).
What are the key properties of 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol?
2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol has a molecular weight of 304.09 g/mol, XLogP of 0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3-iodopyrazolo[4,3-c]pyridin-1-yl)ethanol is sourced from PubChem (CID 67403216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).