C19H21FN4O2 — CID 67403325
2-[6-fluoro-3-[methyl-(1-methylpyrazol-3-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 67403325) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[6-fluoro-3-[methyl-(1-methylpyrazol-3-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-[methyl-(1-methylpyrazol-3-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 67403325 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[6-fluoro-3-[methyl-(1-methylpyrazol-3-yl)amino]-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | CN(c1ccn(C)n1)C1CCc2c(c3cc(F)ccc3n2CC(=O)O)C1 |
| InChI | InChI=1S/C19H21FN4O2/c1-22-8-7-18(21-22)23(2)13-4-6-17-15(10-13)14-9-12(20)3-5-16(14)24(17)11-19(25)26/h3,5,7-9,13H,4,6,10-11H2,1-2H3,(H,25,26) |
| InChIKey | ZJNITCLAIAJHPN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|