About tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane
tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane (PubChem CID 67404704) has the molecular formula C28H36N2OSSn
and a molecular weight of 567.39 g/mol. Its IUPAC name is tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane |
| PubChem CID | 67404704 |
| Molecular Formula | C28H36N2OSSn |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc2sc(-c3ccc(-c4cnco4)cc3)nc2c1 |
| InChI | InChI=1S/C16H9N2OS.3C4H9.Sn/c1-2-4-15-13(3-1)18-16(20-15)12-7-5-11(6-8-12)14-9-17-10-19-14;3*1-3-4-2;/h2-10H;3*1,3-4H2,2H3; |
| InChIKey | OEFOLKBCCKPXNE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane?
The IUPAC name of tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane (CID 67404704) is tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane.
What is the SMILES notation for tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane?
The canonical SMILES for tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane is CCCC[Sn](CCCC)(CCCC)c1ccc2sc(-c3ccc(-c4cnco4)cc3)nc2c1.
What is the InChIKey of tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane?
The InChIKey is OEFOLKBCCKPXNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N2OS.3C4H9.Sn/c1-2-4-15-13(3-1)18-16(20-15)12-7-5-11(6-8-12)14-9-17-10-19-14;3*1-3-4-2;/h2-10H;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane?
tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane has a molecular weight of 567.39 g/mol, XLogP of 8.67, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[2-[4-(1,3-oxazol-5-yl)phenyl]-1,3-benzothiazol-5-yl]stannane is sourced from PubChem (CID 67404704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).