About 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid
1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 67404879) has the molecular formula C9H10F3N3O2
and a molecular weight of 249.19 g/mol. Its IUPAC name is 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid.
Analyze 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid?
The IUPAC name of 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid (CID 67404879) is 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid is NC1(c2cnccn2)CC1.O=C(O)C(F)(F)F.
What is the InChIKey of 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid?
The InChIKey is VOCYYTVHXLWZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2HF3O2/c8-7(1-2-7)6-5-9-3-4-10-6;3-2(4,5)1(6)7/h3-5H,1-2,8H2;(H,6,7).
What are the key properties of 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid?
1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid has a molecular weight of 249.19 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrazin-2-ylcyclopropan-1-amine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 67404879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).