About 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine
3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine (PubChem CID 67404897) has the molecular formula C18H17Cl2N3
and a molecular weight of 346.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine |
| PubChem CID | 67404897 |
| Molecular Formula | C18H17Cl2N3 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine |
| SMILES | Clc1ccc(-c2cn(C3CCNCC3)c3ccncc23)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3/c19-16-2-1-12(9-17(16)20)15-11-23(13-3-6-21-7-4-13)18-5-8-22-10-14(15)18/h1-2,5,8-11,13,21H,3-4,6-7H2 |
| InChIKey | DXYHKIYYCAKPQJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine?
The IUPAC name of 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine (CID 67404897) is 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine is Clc1ccc(-c2cn(C3CCNCC3)c3ccncc23)cc1Cl.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine?
The InChIKey is DXYHKIYYCAKPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3/c19-16-2-1-12(9-17(16)20)15-11-23(13-3-6-21-7-4-13)18-5-8-22-10-14(15)18/h1-2,5,8-11,13,21H,3-4,6-7H2.
What are the key properties of 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine?
3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine has a molecular weight of 346.26 g/mol, XLogP of 4.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1-piperidin-4-ylpyrrolo[3,2-c]pyridine is sourced from PubChem (CID 67404897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).