C23H21IO4 — CID 67405069
2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-iodochromen-4-one (PubChem CID 67405069) has the molecular formula C23H21IO4 and a molecular weight of 488.32 g/mol. Its IUPAC name is 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-iodochromen-4-one.
| Compound Name | 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-iodochromen-4-one |
|---|---|
| PubChem CID | 67405069 |
| Molecular Formula | C23H21IO4 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 488.05 |
| IUPAC Name | 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-iodochromen-4-one |
| SMILES | COc1cccc(C=Cc2oc3ccccc3c(=O)c2I)c1OC1CCCC1 |
| InChI | InChI=1S/C23H21IO4/c1-26-20-12-6-7-15(23(20)27-16-8-2-3-9-16)13-14-19-21(24)22(25)17-10-4-5-11-18(17)28-19/h4-7,10-14,16H,2-3,8-9H2,1H3 |
| InChIKey | DCMYYJDWZOTBCL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|