C18H19NO2S — CID 67405172
(5Z)-5-(dimethylaminomethylidene)-2-(3-methoxyphenyl)-6,7-dihydro-1-benzothiophen-4-one (PubChem CID 67405172) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (5Z)-5-(dimethylaminomethylidene)-2-(3-methoxyphenyl)-6,7-dihydro-1-benzothiophen-4-one.
| Compound Name | (5Z)-5-(dimethylaminomethylidene)-2-(3-methoxyphenyl)-6,7-dihydro-1-benzothiophen-4-one |
|---|---|
| PubChem CID | 67405172 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (5Z)-5-(dimethylaminomethylidene)-2-(3-methoxyphenyl)-6,7-dihydro-1-benzothiophen-4-one |
| SMILES | COc1cccc(-c2cc3c(s2)CC/C(=C/N(C)C)C3=O)c1 |
| InChI | InChI=1S/C18H19NO2S/c1-19(2)11-13-7-8-16-15(18(13)20)10-17(22-16)12-5-4-6-14(9-12)21-3/h4-6,9-11H,7-8H2,1-3H3/b13-11- |
| InChIKey | XUZMYWSHSZWJOM-QBFSEMIESA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|