C28H46ClNO4Si — CID 67405644
tert-butyl 3-[3-chloro-4-tri(propan-2-yl)silyloxyphenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 67405644) has the molecular formula C28H46ClNO4Si and a molecular weight of 524.22 g/mol. Its IUPAC name is tert-butyl 3-[3-chloro-4-tri(propan-2-yl)silyloxyphenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-[3-chloro-4-tri(propan-2-yl)silyloxyphenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 67405644 |
| Molecular Formula | C28H46ClNO4Si |
| Molecular Weight | 524.22 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | tert-butyl 3-[3-chloro-4-tri(propan-2-yl)silyloxyphenyl]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)[Si](Oc1ccc(C2COC3(CCN(C(=O)OC(C)(C)C)CC3)C2)cc1Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H46ClNO4Si/c1-19(2)35(20(3)4,21(5)6)34-25-11-10-22(16-24(25)29)23-17-28(32-18-23)12-14-30(15-13-28)26(31)33-27(7,8)9/h10-11,16,19-21,23H,12-15,17-18H2,1-9H3 |
| InChIKey | HJPZATQERUFTHC-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.22 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|