C8H15NO5 — CID 67405712
(1R,2R,3R,6S,7S)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol (PubChem CID 67405712) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (1R,2R,3R,6S,7S)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol.
| Compound Name | (1R,2R,3R,6S,7S)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol |
|---|---|
| PubChem CID | 67405712 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (1R,2R,3R,6S,7S)-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6,7-tetrol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C2[C@H](O)[C@@H](O)CN21 |
| InChI | InChI=1S/C8H15NO5/c10-2-3-6(12)8(14)5-7(13)4(11)1-9(3)5/h3-8,10-14H,1-2H2/t3-,4+,5?,6-,7-,8-/m1/s1 |
| InChIKey | AXTGOJVKRHFYBT-VNBQHTCMSA-N |
| XLogP | -3.51 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |