C18H20FNO4 — CID 67405868
ethyl 2-(6'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-yl)acetate (PubChem CID 67405868) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is ethyl 2-(6'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-yl)acetate.
| Compound Name | ethyl 2-(6'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-yl)acetate |
|---|---|
| PubChem CID | 67405868 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | ethyl 2-(6'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-carbazole]-9'-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(F)ccc31)CC1(CC2)OCCO1 |
| InChI | InChI=1S/C18H20FNO4/c1-2-22-17(21)11-20-15-4-3-12(19)9-13(15)14-10-18(6-5-16(14)20)23-7-8-24-18/h3-4,9H,2,5-8,10-11H2,1H3 |
| InChIKey | JWKUUMPHMZBKAI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|