C13H21FN2O3 — CID 67406508
methyl 4-[[(2S)-2-fluoropyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylate (PubChem CID 67406508) has the molecular formula C13H21FN2O3 and a molecular weight of 272.32 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-fluoropyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[(2S)-2-fluoropyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67406508 |
| Molecular Formula | C13H21FN2O3 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 4-[[(2S)-2-fluoropyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)N2CCC[C@@H]2F)CC1 |
| InChI | InChI=1S/C13H21FN2O3/c1-19-12(17)9-4-6-10(7-5-9)15-13(18)16-8-2-3-11(16)14/h9-11H,2-8H2,1H3,(H,15,18)/t9?,10?,11-/m1/s1 |
| InChIKey | LWUXWWFNXONALE-VQXHTEKXSA-N |
| XLogP | 1.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|