About (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine
(Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine (PubChem CID 67406569) has the molecular formula C21H30FNO4
and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine |
| PubChem CID | 67406569 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1COC/C=C\COCC2=CC=CC=C2)F |
| InChI | InChI=1S/C21H30FNO4/c1-21(2,3)27-20(24)23-14-18(22)13-19(23)16-26-12-8-7-11-25-15-17-9-5-4-6-10-17/h4-10,18-19H,11-16H2,1-3H3/b8-7-/t18-,19-/m0/s1 |
| InChIKey | AIJRKYSLIRYPQU-XSAZBNQGSA-N |
| XLogP | 3.20 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | 471 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine?
The IUPAC name of (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine (CID 67406569) is tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate.
What is the SMILES notation for (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine?
The canonical SMILES for (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine is CC(C)(C)OC(=O)N1C[C@H](C[C@H]1COC/C=C\COCC2=CC=CC=C2)F.
What is the InChIKey of (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine?
The InChIKey is AIJRKYSLIRYPQU-XSAZBNQGSA-N. The full InChI is InChI=1S/C21H30FNO4/c1-21(2,3)27-20(24)23-14-18(22)13-19(23)16-26-12-8-7-11-25-15-17-9-5-4-6-10-17/h4-10,18-19H,11-16H2,1-3H3/b8-7-/t18-,19-/m0/s1.
What are the key properties of (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine?
(Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine has a molecular weight of 379.50 g/mol, XLogP of 3.20, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-(2S,4S)-2-(4-benzyloxy-2-butenyloxymethyl)-1-(tert-butoxycarbonyl)-4-fluoropyrrolidine is sourced from PubChem (CID 67406569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).