C21H30FNO4 — CID 67406569
tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 67406569) has the molecular formula C21H30FNO4 and a molecular weight of 379.47 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67406569 |
| Molecular Formula | C21H30FNO4 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | tert-butyl (2S,4S)-4-fluoro-2-[[(Z)-4-phenylmethoxybut-2-enoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](F)C[C@H]1COC/C=C\COCc1ccccc1 |
| InChI | InChI=1S/C21H30FNO4/c1-21(2,3)27-20(24)23-14-18(22)13-19(23)16-26-12-8-7-11-25-15-17-9-5-4-6-10-17/h4-10,18-19H,11-16H2,1-3H3/b8-7-/t18-,19-/m0/s1 |
| InChIKey | AIJRKYSLIRYPQU-XSAZBNQGSA-N |
| XLogP | 4.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|