C9H15NO4 — CID 67406642
(1R,2S,8R,8aR)-1,2,8-trihydroxy-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 67406642) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is (1R,2S,8R,8aR)-1,2,8-trihydroxy-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,2S,8R,8aR)-1,2,8-trihydroxy-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 67406642 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (1R,2S,8R,8aR)-1,2,8-trihydroxy-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC1C[C@@H](O)[C@@H]2[C@@H](O)[C@@H](O)CN2C1=O |
| InChI | InChI=1S/C9H15NO4/c1-4-2-5(11)7-8(13)6(12)3-10(7)9(4)14/h4-8,11-13H,2-3H2,1H3/t4?,5-,6+,7-,8+/m1/s1 |
| InChIKey | DDVHWVFDOZJVMS-LKRPSQJTSA-N |
| XLogP | -1.68 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |