C23H18F3N7O — CID 67408018
5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidine-4,6-diamine (PubChem CID 67408018) has the molecular formula C23H18F3N7O and a molecular weight of 465.44 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidine-4,6-diamine.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 67408018 |
| Molecular Formula | C23H18F3N7O |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]pyrimidine-4,6-diamine |
| SMILES | Cc1noc(C)c1-c1c(N)nc(-n2nc(Cc3c(F)ccc(F)c3F)c3ccccc32)nc1N |
| InChI | InChI=1S/C23H18F3N7O/c1-10-18(11(2)34-32-10)19-21(27)29-23(30-22(19)28)33-17-6-4-3-5-12(17)16(31-33)9-13-14(24)7-8-15(25)20(13)26/h3-8H,9H2,1-2H3,(H4,27,28,29,30) |
| InChIKey | RONZZHHXWCWDRT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|