About 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane
6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane (PubChem CID 67408052) has the molecular formula C16H23ClN2O2
and a molecular weight of 310.82 g/mol. Its IUPAC name is 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane.
Molecular Properties
| Compound Name | 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane |
| PubChem CID | 67408052 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane |
| SMILES | CCCCC(C)CC.NC(=O)c1noc2cc(Cl)ccc12 |
| InChI | InChI=1S/C8H5ClN2O2.C8H18/c9-4-1-2-5-6(3-4)13-11-7(5)8(10)12;1-4-6-7-8(3)5-2/h1-3H,(H2,10,12);8H,4-7H2,1-3H3 |
| InChIKey | PMKNYLGFLARELG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane?
The IUPAC name of 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane (CID 67408052) is 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane.
What is the SMILES notation for 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane?
The canonical SMILES for 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane is CCCCC(C)CC.NC(=O)c1noc2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane?
The InChIKey is PMKNYLGFLARELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O2.C8H18/c9-4-1-2-5-6(3-4)13-11-7(5)8(10)12;1-4-6-7-8(3)5-2/h1-3H,(H2,10,12);8H,4-7H2,1-3H3.
What are the key properties of 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane?
6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane has a molecular weight of 310.82 g/mol, XLogP of 4.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,2-benzoxazole-3-carboxamide;3-methylheptane is sourced from PubChem (CID 67408052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).