C14H15F3N2O3 — CID 67408081
2-methyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]butanamide (PubChem CID 67408081) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-methyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]butanamide.
| Compound Name | 2-methyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]butanamide |
|---|---|
| PubChem CID | 67408081 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-methyl-N-[4-(2,2,2-trifluoroethoxy)-1,2-benzoxazol-3-yl]butanamide |
| SMILES | CCC(C)C(=O)Nc1noc2cccc(OCC(F)(F)F)c12 |
| InChI | InChI=1S/C14H15F3N2O3/c1-3-8(2)13(20)18-12-11-9(21-7-14(15,16)17)5-4-6-10(11)22-19-12/h4-6,8H,3,7H2,1-2H3,(H,18,19,20) |
| InChIKey | CCIAZCCSWVZYNJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |