C26H31F2N3O2 — CID 67408083
N'-[1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-2-(2,5-difluorophenyl)ethanimidamide (PubChem CID 67408083) has the molecular formula C26H31F2N3O2 and a molecular weight of 455.55 g/mol. Its IUPAC name is N'-[1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-2-(2,5-difluorophenyl)ethanimidamide.
| Compound Name | N'-[1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-2-(2,5-difluorophenyl)ethanimidamide |
|---|---|
| PubChem CID | 67408083 |
| Molecular Formula | C26H31F2N3O2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N'-[1-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperidin-4-yl]-2-(2,5-difluorophenyl)ethanimidamide |
| SMILES | N/C(Cc1cc(F)ccc1F)=N\C1CCN(C(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H31F2N3O2/c27-21-10-11-23(28)18(16-21)17-24(29)30-22-12-14-31(15-13-22)25(32)26(33,20-8-4-5-9-20)19-6-2-1-3-7-19/h1-3,6-7,10-11,16,20,22,33H,4-5,8-9,12-15,17H2,(H2,29,30)/t26-/m0/s1 |
| InChIKey | UIYUUSFFPWQQJU-SANMLTNESA-N |
| XLogP | 3.93 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|