C8H15NO5 — CID 67408166
5-[(1R,2S,3S)-1,2,3,4-tetrahydroxybutyl]pyrrolidin-2-one (PubChem CID 67408166) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-[(1R,2S,3S)-1,2,3,4-tetrahydroxybutyl]pyrrolidin-2-one.
| Compound Name | 5-[(1R,2S,3S)-1,2,3,4-tetrahydroxybutyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67408166 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 5-[(1R,2S,3S)-1,2,3,4-tetrahydroxybutyl]pyrrolidin-2-one |
| SMILES | O=C1CCC([C@@H](O)[C@H](O)[C@@H](O)CO)N1 |
| InChI | InChI=1S/C8H15NO5/c10-3-5(11)8(14)7(13)4-1-2-6(12)9-4/h4-5,7-8,10-11,13-14H,1-3H2,(H,9,12)/t4?,5-,7+,8+/m0/s1 |
| InChIKey | KKUOSCCLXIHLKF-YCLCYYAASA-N |
| XLogP | -2.66 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |