C29H40FN5O2 — CID 67408996
N-[1-[4-cyclopentyl-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,6a-tetrahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide (PubChem CID 67408996) has the molecular formula C29H40FN5O2 and a molecular weight of 509.67 g/mol. Its IUPAC name is N-[1-[4-cyclopentyl-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,6a-tetrahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide.
| Compound Name | N-[1-[4-cyclopentyl-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,6a-tetrahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 67408996 |
| Molecular Formula | C29H40FN5O2 |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | N-[1-[4-cyclopentyl-6-(6-fluoro-1H-indol-3-yl)-2,3,3a,6a-tetrahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1C(c1c[nH]c3cc(F)ccc13)=CN2C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C29H40FN5O2/c1-17(31-5)27(36)33-26(29(2,3)4)28(37)34-13-12-24-25(34)22(16-35(24)19-8-6-7-9-19)21-15-32-23-14-18(30)10-11-20(21)23/h10-11,14-17,19,24-26,31-32H,6-9,12-13H2,1-5H3,(H,33,36) |
| InChIKey | SHCIWDYEZBBNOJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |