C28H32F3N5O4S2 — CID 67409642
(2R)-N-[(4-propylphenyl)methyl]-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxamide (PubChem CID 67409642) has the molecular formula C28H32F3N5O4S2 and a molecular weight of 623.72 g/mol. Its IUPAC name is (2R)-N-[(4-propylphenyl)methyl]-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-N-[(4-propylphenyl)methyl]-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 67409642 |
| Molecular Formula | C28H32F3N5O4S2 |
| Molecular Weight | 623.72 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | (2R)-N-[(4-propylphenyl)methyl]-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-2-carboxamide |
| SMILES | CCCc1ccc(CNC(=O)[C@H]2CN(c3nc4c(s3)CNCC4)CCN2S(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H32F3N5O4S2/c1-2-3-19-4-6-20(7-5-19)16-33-26(37)24-18-35(27-34-23-12-13-32-17-25(23)41-27)14-15-36(24)42(38,39)22-10-8-21(9-11-22)40-28(29,30)31/h4-11,24,32H,2-3,12-18H2,1H3,(H,33,37)/t24-/m1/s1 |
| InChIKey | OEWJGPKJKALNRX-XMMPIXPASA-N |
| XLogP | 3.84 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.72 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |