C37H48N6O7S2 — CID 67410195
(7Z)-N-[ethyl(methyl)sulfamoyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide (PubChem CID 67410195) has the molecular formula C37H48N6O7S2 and a molecular weight of 752.96 g/mol. Its IUPAC name is (7Z)-N-[ethyl(methyl)sulfamoyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide.
| Compound Name | (7Z)-N-[ethyl(methyl)sulfamoyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 67410195 |
| Molecular Formula | C37H48N6O7S2 |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | (7Z)-N-[ethyl(methyl)sulfamoyl]-17-[7-methoxy-2-(4-propan-2-yl-1,3-thiazol-2-yl)quinolin-4-yl]oxy-13-methyl-2,14-dioxo-3,13-diazatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxamide |
| SMILES | CCN(C)S(=O)(=O)NC(=O)C12CC1/C=C\CCCCN(C)C(=O)C1CC(Oc3cc(-c4nc(C(C)C)cs4)nc4cc(OC)ccc34)CC1C(=O)N2 |
| InChI | InChI=1S/C37H48N6O7S2/c1-7-43(5)52(47,48)41-36(46)37-20-23(37)12-10-8-9-11-15-42(4)35(45)28-17-25(16-27(28)33(44)40-37)50-32-19-30(34-39-31(21-51-34)22(2)3)38-29-18-24(49-6)13-14-26(29)32/h10,12-14,18-19,21-23,25,27-28H,7-9,11,15-17,20H2,1-6H3,(H,40,44)(H,41,46)/b12-10- |
| InChIKey | ZJIWVNZRMRBQIS-BENRWUELSA-N |
| XLogP | 4.65 |
| TPSA | 160.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|