C20H14Cl2F3N5O3 — CID 67410828
5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 67410828) has the molecular formula C20H14Cl2F3N5O3 and a molecular weight of 500.26 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 67410828 |
| Molecular Formula | C20H14Cl2F3N5O3 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(-c3ccccc3Cl)no2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C20H14Cl2F3N5O3/c21-12-7-5-11(6-8-12)18-27-30(19(32)29(18)9-15(31)20(23,24)25)10-16-26-17(28-33-16)13-3-1-2-4-14(13)22/h1-8,15,31H,9-10H2/t15-/m0/s1 |
| InChIKey | JLVJCHONPFWWHW-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |