C25H38FN3O3Si — CID 67411127
tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-3a-(6-fluoro-1H-indol-3-yl)-1,2,3,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67411127) has the molecular formula C25H38FN3O3Si and a molecular weight of 475.68 g/mol. Its IUPAC name is tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-3a-(6-fluoro-1H-indol-3-yl)-1,2,3,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-3a-(6-fluoro-1H-indol-3-yl)-1,2,3,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67411127 |
| Molecular Formula | C25H38FN3O3Si |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | tert-butyl 6-[tert-butyl(dimethyl)silyl]oxy-3a-(6-fluoro-1H-indol-3-yl)-1,2,3,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)C2NCCC21c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C25H38FN3O3Si/c1-23(2,3)31-22(30)29-15-20(32-33(7,8)24(4,5)6)21-25(29,11-12-27-21)18-14-28-19-13-16(26)9-10-17(18)19/h9-10,13-14,20-21,27-28H,11-12,15H2,1-8H3 |
| InChIKey | DQUNSHZRHLNCFW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|