C19H20N8O2 — CID 67411211
methyl 2-[4-[9-(1H-indazol-6-yl)purin-2-yl]piperazin-1-yl]acetate (PubChem CID 67411211) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is methyl 2-[4-[9-(1H-indazol-6-yl)purin-2-yl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[9-(1H-indazol-6-yl)purin-2-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 67411211 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | methyl 2-[4-[9-(1H-indazol-6-yl)purin-2-yl]piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(c2ncc3ncn(-c4ccc5cn[nH]c5c4)c3n2)CC1 |
| InChI | InChI=1S/C19H20N8O2/c1-29-17(28)11-25-4-6-26(7-5-25)19-20-10-16-18(23-19)27(12-21-16)14-3-2-13-9-22-24-15(13)8-14/h2-3,8-10,12H,4-7,11H2,1H3,(H,22,24) |
| InChIKey | CHZSUXQZBFHSTH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |