About 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide
5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide (PubChem CID 67411337) has the molecular formula C5H4Br2F3NS
and a molecular weight of 326.96 g/mol. Its IUPAC name is 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide |
| PubChem CID | 67411337 |
| Molecular Formula | C5H4Br2F3NS |
| Molecular Weight | 326.96 g/mol |
| Exact Mass | 324.84 |
| IUPAC Name | 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide |
| SMILES | Br.Cc1nc(C(F)(F)F)c(Br)s1 |
| InChI | InChI=1S/C5H3BrF3NS.BrH/c1-2-10-3(4(6)11-2)5(7,8)9;/h1H3;1H |
| InChIKey | XDVFWFZYOJUBHM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.96 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide?
The IUPAC name of 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide (CID 67411337) is 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide.
What is the SMILES notation for 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide?
The canonical SMILES for 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide is Br.Cc1nc(C(F)(F)F)c(Br)s1.
What is the InChIKey of 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide?
The InChIKey is XDVFWFZYOJUBHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrF3NS.BrH/c1-2-10-3(4(6)11-2)5(7,8)9;/h1H3;1H.
What are the key properties of 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide?
5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide has a molecular weight of 326.96 g/mol, XLogP of 3.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-4-(trifluoromethyl)-1,3-thiazole;hydrobromide is sourced from PubChem (CID 67411337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).