About ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate
ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate (PubChem CID 67411597) has the molecular formula C27H29F3N2O3
and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate |
| PubChem CID | 67411597 |
| Molecular Formula | C27H29F3N2O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate |
| SMILES | CCCCN(C(=O)c1cc(C)n(-c2ccccc2C(F)(F)F)c1C)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H29F3N2O3/c1-5-7-16-31(21-14-12-20(13-15-21)26(34)35-6-2)25(33)22-17-18(3)32(19(22)4)24-11-9-8-10-23(24)27(28,29)30/h8-15,17H,5-7,16H2,1-4H3 |
| InChIKey | LLDGVNHIXSBBMF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The IUPAC name of ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate (CID 67411597) is ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The canonical SMILES for ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate is CCCCN(C(=O)c1cc(C)n(-c2ccccc2C(F)(F)F)c1C)c1ccc(C(=O)OCC)cc1.
What is the InChIKey of ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
The InChIKey is LLDGVNHIXSBBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F3N2O3/c1-5-7-16-31(21-14-12-20(13-15-21)26(34)35-6-2)25(33)22-17-18(3)32(19(22)4)24-11-9-8-10-23(24)27(28,29)30/h8-15,17H,5-7,16H2,1-4H3.
What are the key properties of ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate?
ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate has a molecular weight of 486.53 g/mol, XLogP of 6.74, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[butyl-[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]benzoate is sourced from PubChem (CID 67411597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).