C12H24O6 — CID 67411650
(2R,3R,4R,5R,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 67411650) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67411650 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-hexoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCO[C@@H]1O[C@H](CO)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h8-16H,2-7H2,1H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | JVAZJLFFSJARQM-IYKVGLELSA-N |
| XLogP | -0.62 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|