C20H21F2N3O2S — CID 67411747
(3S,3aS,6aR)-2-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 67411747) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-2-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67411747 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (3S,3aS,6aR)-2-[5-(3,4-difluorophenyl)-2-methyl-1,3-thiazole-4-carbonyl]-5-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | Cc1nc(C(=O)N2C[C@@H]3CC(C)C[C@@H]3[C@H]2C(N)=O)c(-c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C20H21F2N3O2S/c1-9-5-12-8-25(17(19(23)26)13(12)6-9)20(27)16-18(28-10(2)24-16)11-3-4-14(21)15(22)7-11/h3-4,7,9,12-13,17H,5-6,8H2,1-2H3,(H2,23,26)/t9?,12-,13-,17-/m0/s1 |
| InChIKey | NMHNRGULKDWGHX-RGVYDBRKSA-N |
| XLogP | 3.37 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |