About CID 67411928
CID 67411928 (PubChem CID 67411928) has the molecular formula C7H7N3NaO
and a molecular weight of 172.14 g/mol.
Molecular Properties
| Compound Name | CID 67411928 |
| PubChem CID | 67411928 |
| Molecular Formula | C7H7N3NaO |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | — |
| SMILES | COc1nc2ccncc2[nH]1.[Na] |
| InChI | InChI=1S/C7H7N3O.Na/c1-11-7-9-5-2-3-8-4-6(5)10-7;/h2-4H,1H3,(H,9,10); |
| InChIKey | SNJWENANNHFWSR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 67411928 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67411928?
The IUPAC name of CID 67411928 (CID 67411928) is not available.
What is the SMILES notation for CID 67411928?
The canonical SMILES for CID 67411928 is COc1nc2ccncc2[nH]1.[Na].
What is the InChIKey of CID 67411928?
The InChIKey is SNJWENANNHFWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O.Na/c1-11-7-9-5-2-3-8-4-6(5)10-7;/h2-4H,1H3,(H,9,10);.
What are the key properties of CID 67411928?
CID 67411928 has a molecular weight of 172.14 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67411928 is sourced from PubChem (CID 67411928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).