C17H16Cl3N3O3S2 — CID 67412306
2-[2-[(5R)-2-oxo-5-[(3,4,5-trichloroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 67412306) has the molecular formula C17H16Cl3N3O3S2 and a molecular weight of 480.83 g/mol. Its IUPAC name is 2-[2-[(5R)-2-oxo-5-[(3,4,5-trichloroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(5R)-2-oxo-5-[(3,4,5-trichloroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67412306 |
| Molecular Formula | C17H16Cl3N3O3S2 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | 2-[2-[(5R)-2-oxo-5-[(3,4,5-trichloroanilino)methyl]pyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(SCCN2C(=O)CC[C@@H]2CNc2cc(Cl)c(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H16Cl3N3O3S2/c18-11-5-9(6-12(19)15(11)20)21-7-10-1-2-14(24)23(10)3-4-27-17-22-13(8-28-17)16(25)26/h5-6,8,10,21H,1-4,7H2,(H,25,26)/t10-/m1/s1 |
| InChIKey | PWZHNXCGNAHOQG-SNVBAGLBSA-N |
| XLogP | 5.00 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|