C21H17ClF3N7O2 — CID 67412746
[4,6-diamino-2-[5-chloro-3-[(2,3,5-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-ethylcarbamic acid (PubChem CID 67412746) has the molecular formula C21H17ClF3N7O2 and a molecular weight of 491.86 g/mol. Its IUPAC name is [4,6-diamino-2-[5-chloro-3-[(2,3,5-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-ethylcarbamic acid.
| Compound Name | [4,6-diamino-2-[5-chloro-3-[(2,3,5-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-ethylcarbamic acid |
|---|---|
| PubChem CID | 67412746 |
| Molecular Formula | C21H17ClF3N7O2 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | [4,6-diamino-2-[5-chloro-3-[(2,3,5-trifluorophenyl)methyl]indazol-1-yl]pyrimidin-5-yl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)c1c(N)nc(-n2nc(Cc3cc(F)cc(F)c3F)c3cc(Cl)ccc32)nc1N |
| InChI | InChI=1S/C21H17ClF3N7O2/c1-2-31(21(33)34)17-18(26)28-20(29-19(17)27)32-15-4-3-10(22)7-12(15)14(30-32)6-9-5-11(23)8-13(24)16(9)25/h3-5,7-8H,2,6H2,1H3,(H,33,34)(H4,26,27,28,29) |
| InChIKey | NCSQHOLXDBFEMF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|