C19H20FN3O2 — CID 67413396
[1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-prop-2-enylcarbamic acid (PubChem CID 67413396) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-prop-2-enylcarbamic acid.
| Compound Name | [1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 67413396 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [1-(4-fluorophenyl)-5,6-dimethyl-4H-indazol-5-yl]-prop-2-enylcarbamic acid |
| SMILES | C=CCN(C(=O)O)C1(C)Cc2cnn(-c3ccc(F)cc3)c2C=C1C |
| InChI | InChI=1S/C19H20FN3O2/c1-4-9-22(18(24)25)19(3)11-14-12-21-23(17(14)10-13(19)2)16-7-5-15(20)6-8-16/h4-8,10,12H,1,9,11H2,2-3H3,(H,24,25) |
| InChIKey | BDEXPEYMBIIUQR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|