C48H86N4O4 — CID 67414035
1-N,2-N,3-N,4-N-tetrakis(3-butylcyclohexyl)butane-1,2,3,4-tetracarboxamide (PubChem CID 67414035) has the molecular formula C48H86N4O4 and a molecular weight of 783.24 g/mol. Its IUPAC name is 1-N,2-N,3-N,4-N-tetrakis(3-butylcyclohexyl)butane-1,2,3,4-tetracarboxamide.
| Compound Name | 1-N,2-N,3-N,4-N-tetrakis(3-butylcyclohexyl)butane-1,2,3,4-tetracarboxamide |
|---|---|
| PubChem CID | 67414035 |
| Molecular Formula | C48H86N4O4 |
| Molecular Weight | 783.24 g/mol |
| Exact Mass | 782.66 |
| IUPAC Name | 1-N,2-N,3-N,4-N-tetrakis(3-butylcyclohexyl)butane-1,2,3,4-tetracarboxamide |
| SMILES | CCCCC1CCCC(NC(=O)CC(C(=O)NC2CCCC(CCCC)C2)C(CC(=O)NC2CCCC(CCCC)C2)C(=O)NC2CCCC(CCCC)C2)C1 |
| InChI | InChI=1S/C48H86N4O4/c1-5-9-17-35-21-13-25-39(29-35)49-45(53)33-43(47(55)51-41-27-15-23-37(31-41)19-11-7-3)44(48(56)52-42-28-16-24-38(32-42)20-12-8-4)34-46(54)50-40-26-14-22-36(30-40)18-10-6-2/h35-44H,5-34H2,1-4H3,(H,49,53)(H,50,54)(H,51,55)(H,52,56) |
| InChIKey | PIXCVLIUULSHKL-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.24 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |