C25H25BrN2O6S — CID 67414701
4-bromo-2-(2-methylphenyl)-4-[[1-(4-methylsulfonylphenyl)-2-oxo-4-pyridinyl]oxy]piperidine-1-carboxylic acid (PubChem CID 67414701) has the molecular formula C25H25BrN2O6S and a molecular weight of 561.45 g/mol. Its IUPAC name is 4-bromo-2-(2-methylphenyl)-4-[[1-(4-methylsulfonylphenyl)-2-oxo-4-pyridinyl]oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-bromo-2-(2-methylphenyl)-4-[[1-(4-methylsulfonylphenyl)-2-oxo-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67414701 |
| Molecular Formula | C25H25BrN2O6S |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 4-bromo-2-(2-methylphenyl)-4-[[1-(4-methylsulfonylphenyl)-2-oxo-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
| SMILES | Cc1ccccc1C1CC(Br)(Oc2ccn(-c3ccc(S(C)(=O)=O)cc3)c(=O)c2)CCN1C(=O)O |
| InChI | InChI=1S/C25H25BrN2O6S/c1-17-5-3-4-6-21(17)22-16-25(26,12-14-28(22)24(30)31)34-19-11-13-27(23(29)15-19)18-7-9-20(10-8-18)35(2,32)33/h3-11,13,15,22H,12,14,16H2,1-2H3,(H,30,31) |
| InChIKey | NOQPDQTXSQPUEQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|