About 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine
3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine (PubChem CID 67415119) has the molecular formula C19H23N5O
and a molecular weight of 337.43 g/mol. Its IUPAC name is 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine |
| PubChem CID | 67415119 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine |
| SMILES | COCCc1ccc(-c2c(C)nc3c(N4CCCC4)nccn23)cn1 |
| InChI | InChI=1S/C19H23N5O/c1-14-17(15-5-6-16(21-13-15)7-12-25-2)24-11-8-20-18(19(24)22-14)23-9-3-4-10-23/h5-6,8,11,13H,3-4,7,9-10,12H2,1-2H3 |
| InChIKey | COAVUEUBGSYOPD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine?
The IUPAC name of 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine (CID 67415119) is 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine.
What is the SMILES notation for 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine?
The canonical SMILES for 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine is COCCc1ccc(-c2c(C)nc3c(N4CCCC4)nccn23)cn1.
What is the InChIKey of 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine?
The InChIKey is COAVUEUBGSYOPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O/c1-14-17(15-5-6-16(21-13-15)7-12-25-2)24-11-8-20-18(19(24)22-14)23-9-3-4-10-23/h5-6,8,11,13H,3-4,7,9-10,12H2,1-2H3.
What are the key properties of 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine?
3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine has a molecular weight of 337.43 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2-methoxyethyl)-3-pyridinyl]-2-methyl-8-pyrrolidin-1-ylimidazo[1,2-a]pyrazine is sourced from PubChem (CID 67415119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).