C23H30Cl3NO2 — CID 67415242
(2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5,7,8-trichloronaphthalen-2-yl]propan-1-ol (PubChem CID 67415242) has the molecular formula C23H30Cl3NO2 and a molecular weight of 458.86 g/mol. Its IUPAC name is (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5,7,8-trichloronaphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5,7,8-trichloronaphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 67415242 |
| Molecular Formula | C23H30Cl3NO2 |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5,7,8-trichloronaphthalen-2-yl]propan-1-ol |
| SMILES | CC(C)(C)C1CCC(Oc2c(Cl)c(Cl)c3cc([C@@](C)(N)CO)ccc3c2Cl)CC1 |
| InChI | InChI=1S/C23H30Cl3NO2/c1-22(2,3)13-5-8-15(9-6-13)29-21-19(25)16-10-7-14(23(4,27)12-28)11-17(16)18(24)20(21)26/h7,10-11,13,15,28H,5-6,8-9,12,27H2,1-4H3/t13?,15?,23-/m0/s1 |
| InChIKey | SWKFTZOBRSRWKU-QQTLNFAQSA-N |
| XLogP | 6.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|