C25H29ClF3N3O3S — CID 67415385
(2S)-N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(ethylamino)-3-phenylpropanamide (PubChem CID 67415385) has the molecular formula C25H29ClF3N3O3S and a molecular weight of 544.04 g/mol. Its IUPAC name is (2S)-N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(ethylamino)-3-phenylpropanamide.
| Compound Name | (2S)-N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(ethylamino)-3-phenylpropanamide |
|---|---|
| PubChem CID | 67415385 |
| Molecular Formula | C25H29ClF3N3O3S |
| Molecular Weight | 544.04 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | (2S)-N-[(3aR,4S,6aS)-2-[2-chloro-4-(trifluoromethyl)phenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2-(ethylamino)-3-phenylpropanamide |
| SMILES | CCN[C@@H](Cc1ccccc1)C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3Cl)C[C@@H]21 |
| InChI | InChI=1S/C25H29ClF3N3O3S/c1-2-30-22(12-16-6-4-3-5-7-16)24(33)31-21-10-8-17-14-32(15-19(17)21)36(34,35)23-11-9-18(13-20(23)26)25(27,28)29/h3-7,9,11,13,17,19,21-22,30H,2,8,10,12,14-15H2,1H3,(H,31,33)/t17-,19+,21+,22+/m1/s1 |
| InChIKey | VJJCODFOWZKNAB-HQMSXXKGSA-N |
| XLogP | 4.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.04 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |