C7H11NS — CID 67415469
2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine (PubChem CID 67415469) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine.
| Compound Name | 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 67415469 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine |
| SMILES | C1=C2SCCC2CNC1 |
| InChI | InChI=1S/C7H11NS/c1-3-8-5-6-2-4-9-7(1)6/h1,6,8H,2-5H2 |
| InChIKey | ZYERXSQTYFSCKD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |