C29H51N3O6 — CID 67415565
[(3R)-3-carboxy-5-methyl-2-[6-(4-phenylbutoxy)hexylcarbamoylamino]hexyl]-trimethylazanium formate (PubChem CID 67415565) has the molecular formula C29H51N3O6 and a molecular weight of 537.74 g/mol. Its IUPAC name is [(3R)-3-carboxy-5-methyl-2-[6-(4-phenylbutoxy)hexylcarbamoylamino]hexyl]-trimethylazanium formate.
| Compound Name | [(3R)-3-carboxy-5-methyl-2-[6-(4-phenylbutoxy)hexylcarbamoylamino]hexyl]-trimethylazanium formate |
|---|---|
| PubChem CID | 67415565 |
| Molecular Formula | C29H51N3O6 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | [(3R)-3-carboxy-5-methyl-2-[6-(4-phenylbutoxy)hexylcarbamoylamino]hexyl]-trimethylazanium formate |
| SMILES | CC(C)C[C@@H](C(=O)O)C(C[N+](C)(C)C)NC(=O)NCCCCCCOCCCCc1ccccc1.O=C[O-] |
| InChI | InChI=1S/C28H49N3O4.CH2O2/c1-23(2)21-25(27(32)33)26(22-31(3,4)5)30-28(34)29-18-12-6-7-13-19-35-20-14-11-17-24-15-9-8-10-16-24;2-1-3/h8-10,15-16,23,25-26H,6-7,11-14,17-22H2,1-5H3,(H2-,29,30,32,33,34);1H,(H,2,3)/t25-,26?;/m1./s1 |
| InChIKey | RFMMGKWMNHFZMU-FJGRWCOESA-N |
| XLogP | 3.07 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|