C42H58O6 — CID 67415839
bis[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] butanedioate (PubChem CID 67415839) has the molecular formula C42H58O6 and a molecular weight of 658.92 g/mol. Its IUPAC name is bis[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] butanedioate.
| Compound Name | bis[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] butanedioate |
|---|---|
| PubChem CID | 67415839 |
| Molecular Formula | C42H58O6 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | bis[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] butanedioate |
| SMILES | C[C@]12CC[C@H](OC(=O)CCC(=O)O[C@H]3CC[C@@]4(C)C(=CC[C@@H]5[C@@H]4CC[C@]4(C)C(=O)CC[C@@H]54)C3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C42H58O6/c1-39-19-15-27(23-25(39)5-7-29-31-9-11-35(43)41(31,3)21-17-33(29)39)47-37(45)13-14-38(46)48-28-16-20-40(2)26(24-28)6-8-30-32-10-12-36(44)42(32,4)22-18-34(30)40/h5-6,27-34H,7-24H2,1-4H3/t27-,28-,29-,30-,31-,32-,33-,34-,39-,40-,41-,42-/m0/s1 |
| InChIKey | CTOVXBBMQNILFV-CFTKTRHXSA-N |
| XLogP | 8.65 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|