C38H54Br2N2O2S2 — CID 67416023
1,4-bis(5-bromothiophen-2-yl)-2,5-bis(2-butyloctyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 67416023) has the molecular formula C38H54Br2N2O2S2 and a molecular weight of 794.80 g/mol. Its IUPAC name is 1,4-bis(5-bromothiophen-2-yl)-2,5-bis(2-butyloctyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(5-bromothiophen-2-yl)-2,5-bis(2-butyloctyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 67416023 |
| Molecular Formula | C38H54Br2N2O2S2 |
| Molecular Weight | 794.80 g/mol |
| Exact Mass | 792.20 |
| IUPAC Name | 1,4-bis(5-bromothiophen-2-yl)-2,5-bis(2-butyloctyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCC(CCCC)CN1C(=O)C2=C(c3ccc(Br)s3)N(CC(CCCC)CCCCCC)C(=O)C2=C1c1ccc(Br)s1 |
| InChI | InChI=1S/C38H54Br2N2O2S2/c1-5-9-13-15-19-27(17-11-7-3)25-41-35(29-21-23-31(39)45-29)33-34(37(41)43)36(30-22-24-32(40)46-30)42(38(33)44)26-28(18-12-8-4)20-16-14-10-6-2/h21-24,27-28H,5-20,25-26H2,1-4H3 |
| InChIKey | JLJXFNQGQGQPQC-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.80 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|