About 6-(1H-pyrrol-2-yl)-1,3-benzothiazole
6-(1H-pyrrol-2-yl)-1,3-benzothiazole (PubChem CID 67416063) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 6-(1H-pyrrol-2-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(1H-pyrrol-2-yl)-1,3-benzothiazole |
| PubChem CID | 67416063 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 6-(1H-pyrrol-2-yl)-1,3-benzothiazole |
| SMILES | c1c[nH]c(-c2ccc3ncsc3c2)c1 |
| InChI | InChI=1S/C11H8N2S/c1-2-9(12-5-1)8-3-4-10-11(6-8)14-7-13-10/h1-7,12H |
| InChIKey | IRDIKIKDSZOQEG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(1H-pyrrol-2-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-pyrrol-2-yl)-1,3-benzothiazole?
The IUPAC name of 6-(1H-pyrrol-2-yl)-1,3-benzothiazole (CID 67416063) is 6-(1H-pyrrol-2-yl)-1,3-benzothiazole.
What is the SMILES notation for 6-(1H-pyrrol-2-yl)-1,3-benzothiazole?
The canonical SMILES for 6-(1H-pyrrol-2-yl)-1,3-benzothiazole is c1c[nH]c(-c2ccc3ncsc3c2)c1.
What is the InChIKey of 6-(1H-pyrrol-2-yl)-1,3-benzothiazole?
The InChIKey is IRDIKIKDSZOQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-9(12-5-1)8-3-4-10-11(6-8)14-7-13-10/h1-7,12H.
What are the key properties of 6-(1H-pyrrol-2-yl)-1,3-benzothiazole?
6-(1H-pyrrol-2-yl)-1,3-benzothiazole has a molecular weight of 200.27 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-pyrrol-2-yl)-1,3-benzothiazole is sourced from PubChem (CID 67416063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).