About (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid
(2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid (PubChem CID 67416223) has the molecular formula C12H13F2NO3
and a molecular weight of 257.24 g/mol. Its IUPAC name is (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid |
| PubChem CID | 67416223 |
| Molecular Formula | C12H13F2NO3 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid |
| SMILES | CO[C@H]1C(c2ccc(F)c(F)c2)CCN1C(=O)O |
| InChI | InChI=1S/C12H13F2NO3/c1-18-11-8(4-5-15(11)12(16)17)7-2-3-9(13)10(14)6-7/h2-3,6,8,11H,4-5H2,1H3,(H,16,17)/t8?,11-/m0/s1 |
| InChIKey | PQCYDDYAESWQAS-LYNSQETBSA-N |
| XLogP | 2.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid?
The IUPAC name of (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid (CID 67416223) is (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid.
What is the SMILES notation for (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid?
The canonical SMILES for (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid is CO[C@H]1C(c2ccc(F)c(F)c2)CCN1C(=O)O.
What is the InChIKey of (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid?
The InChIKey is PQCYDDYAESWQAS-LYNSQETBSA-N. The full InChI is InChI=1S/C12H13F2NO3/c1-18-11-8(4-5-15(11)12(16)17)7-2-3-9(13)10(14)6-7/h2-3,6,8,11H,4-5H2,1H3,(H,16,17)/t8?,11-/m0/s1.
What are the key properties of (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid?
(2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid has a molecular weight of 257.24 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(3,4-difluorophenyl)-2-methoxypyrrolidine-1-carboxylic acid is sourced from PubChem (CID 67416223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).