C14H29NO — CID 67416523
2,2,6,6-tetramethyl-1-pentylpiperidin-4-ol (PubChem CID 67416523) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-pentylpiperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-pentylpiperidin-4-ol |
|---|---|
| PubChem CID | 67416523 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-pentylpiperidin-4-ol |
| SMILES | CCCCCN1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C14H29NO/c1-6-7-8-9-15-13(2,3)10-12(16)11-14(15,4)5/h12,16H,6-11H2,1-5H3 |
| InChIKey | QEUULAOXOMKRHI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|