About 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride
1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride (PubChem CID 67416859) has the molecular formula C14H20Cl2N4
and a molecular weight of 315.25 g/mol. Its IUPAC name is 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride |
| PubChem CID | 67416859 |
| Molecular Formula | C14H20Cl2N4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride |
| SMILES | C[n+]1cc[nH]c1CCN1CCc2ccc(N)cc21.Cl.[Cl-] |
| InChI | InChI=1S/C14H18N4.2ClH/c1-17-9-6-16-14(17)5-8-18-7-4-11-2-3-12(15)10-13(11)18;;/h2-3,6,9-10H,4-5,7-8,15H2,1H3;2*1H |
| InChIKey | DRSBYQBTWNCYCH-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 48.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride?
The IUPAC name of 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride (CID 67416859) is 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride.
What is the SMILES notation for 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride?
The canonical SMILES for 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride is C[n+]1cc[nH]c1CCN1CCc2ccc(N)cc21.Cl.[Cl-].
What is the InChIKey of 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride?
The InChIKey is DRSBYQBTWNCYCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4.2ClH/c1-17-9-6-16-14(17)5-8-18-7-4-11-2-3-12(15)10-13(11)18;;/h2-3,6,9-10H,4-5,7-8,15H2,1H3;2*1H.
What are the key properties of 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride?
1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride has a molecular weight of 315.25 g/mol, XLogP of -1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-methyl-1H-imidazol-3-ium-2-yl)ethyl]-2,3-dihydroindol-6-amine;chloride;hydrochloride is sourced from PubChem (CID 67416859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).