About 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride
6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride (PubChem CID 67416939) has the molecular formula C9H11ClFNO2
and a molecular weight of 219.64 g/mol. Its IUPAC name is 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride |
| PubChem CID | 67416939 |
| Molecular Formula | C9H11ClFNO2 |
| Molecular Weight | 219.64 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride |
| SMILES | CNc1cc(F)cc2c1OCOC2.Cl |
| InChI | InChI=1S/C9H10FNO2.ClH/c1-11-8-3-7(10)2-6-4-12-5-13-9(6)8;/h2-3,11H,4-5H2,1H3;1H |
| InChIKey | BDJBPUYPFMGYEO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride?
The IUPAC name of 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride (CID 67416939) is 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride.
What is the SMILES notation for 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride?
The canonical SMILES for 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride is CNc1cc(F)cc2c1OCOC2.Cl.
What is the InChIKey of 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride?
The InChIKey is BDJBPUYPFMGYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2.ClH/c1-11-8-3-7(10)2-6-4-12-5-13-9(6)8;/h2-3,11H,4-5H2,1H3;1H.
What are the key properties of 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride?
6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride has a molecular weight of 219.64 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-methyl-4H-1,3-benzodioxin-8-amine;hydrochloride is sourced from PubChem (CID 67416939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).