C13H17ClN6O7S — CID 67417073
methyl 3-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-5-chloro-2-methyl-1H-pyrazole-5-carboxylate (PubChem CID 67417073) has the molecular formula C13H17ClN6O7S and a molecular weight of 436.83 g/mol. Its IUPAC name is methyl 3-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-5-chloro-2-methyl-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 3-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-5-chloro-2-methyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 67417073 |
| Molecular Formula | C13H17ClN6O7S |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | methyl 3-[carbamoyl-(4,6-dimethoxypyrimidin-2-yl)sulfamoyl]-5-chloro-2-methyl-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)C1(Cl)C=C(S(=O)(=O)N(C(N)=O)c2nc(OC)cc(OC)n2)N(C)N1 |
| InChI | InChI=1S/C13H17ClN6O7S/c1-19-9(6-13(14,18-19)10(21)27-4)28(23,24)20(11(15)22)12-16-7(25-2)5-8(17-12)26-3/h5-6,18H,1-4H3,(H2,15,22) |
| InChIKey | NHTAQZIYTXTQQD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|