About 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole
3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole (PubChem CID 67417382) has the molecular formula C6H5N5S
and a molecular weight of 179.21 g/mol. Its IUPAC name is 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole.
Analyze 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole?
The IUPAC name of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole (CID 67417382) is 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole.
What is the SMILES notation for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole?
The canonical SMILES for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole is C(=Cc1ncn[nH]1)c1ncsn1.
What is the InChIKey of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole?
The InChIKey is BBLDSDWNHZEXOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5S/c1(5-7-3-9-10-5)2-6-8-4-12-11-6/h1-4H,(H,7,9,10).
What are the key properties of 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole?
3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole has a molecular weight of 179.21 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1H-1,2,4-triazol-5-yl)ethenyl]-1,2,4-thiadiazole is sourced from PubChem (CID 67417382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).